C16H10ClF3N4O4 — CID 19912214
2-[4-chloro-2-fluoro-5-(4-nitrophenoxy)phenyl]-4-(difluoromethyl)-5-methyl-1,2,4-triazol-3-one (PubChem CID 19912214) has the molecular formula C16H10ClF3N4O4 and a molecular weight of 414.73 g/mol. Its IUPAC name is 2-[4-chloro-2-fluoro-5-(4-nitrophenoxy)phenyl]-4-(difluoromethyl)-5-methyl-1,2,4-triazol-3-one.
| Compound Name | 2-[4-chloro-2-fluoro-5-(4-nitrophenoxy)phenyl]-4-(difluoromethyl)-5-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 19912214 |
| Molecular Formula | C16H10ClF3N4O4 |
| Molecular Weight | 414.73 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 2-[4-chloro-2-fluoro-5-(4-nitrophenoxy)phenyl]-4-(difluoromethyl)-5-methyl-1,2,4-triazol-3-one |
| SMILES | Cc1nn(-c2cc(Oc3ccc([N+](=O)[O-])cc3)c(Cl)cc2F)c(=O)n1C(F)F |
| InChI | InChI=1S/C16H10ClF3N4O4/c1-8-21-23(16(25)22(8)15(19)20)13-7-14(11(17)6-12(13)18)28-10-4-2-9(3-5-10)24(26)27/h2-7,15H,1H3 |
| InChIKey | FDPDPIOXSVCHJZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 92.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.73 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|