About [3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate
[3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate (PubChem CID 22074860) has the molecular formula C13H15ClN6O8S
and a molecular weight of 450.82 g/mol. Its IUPAC name is [3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate.
Molecular Properties
| Compound Name | [3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate |
| PubChem CID | 22074860 |
| Molecular Formula | C13H15ClN6O8S |
| Molecular Weight | 450.82 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | [3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate |
| SMILES | COC(=O)Oc1c(Cl)nn(C)c1S(=O)(=O)NC(=O)Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C13H15ClN6O8S/c1-20-10(8(9(14)18-20)28-13(22)27-4)29(23,24)19-12(21)17-11-15-6(25-2)5-7(16-11)26-3/h5H,1-4H3,(H2,15,16,17,19,21) |
| InChIKey | RAQIHKADUIRSIH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 172.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.82 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze [3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate?
The IUPAC name of [3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate (CID 22074860) is [3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate.
What is the SMILES notation for [3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate?
The canonical SMILES for [3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate is COC(=O)Oc1c(Cl)nn(C)c1S(=O)(=O)NC(=O)Nc1nc(OC)cc(OC)n1.
What is the InChIKey of [3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate?
The InChIKey is RAQIHKADUIRSIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN6O8S/c1-20-10(8(9(14)18-20)28-13(22)27-4)29(23,24)19-12(21)17-11-15-6(25-2)5-7(16-11)26-3/h5H,1-4H3,(H2,15,16,17,19,21).
What are the key properties of [3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate?
[3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate has a molecular weight of 450.82 g/mol, XLogP of 0.54, 6 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1-methylpyrazol-4-yl] methyl carbonate is sourced from PubChem (CID 22074860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).