C7H10N4O4 — CID 134822106
1-(4,6-dimethoxypyrimidin-2-yl)-3-hydroxyurea (PubChem CID 134822106) has the molecular formula C7H10N4O4 and a molecular weight of 214.18 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)-3-hydroxyurea.
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-hydroxyurea |
|---|---|
| PubChem CID | 134822106 |
| Molecular Formula | C7H10N4O4 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-hydroxyurea |
| SMILES | COc1cc(OC)nc(NC(=O)NO)n1 |
| InChI | InChI=1S/C7H10N4O4/c1-14-4-3-5(15-2)9-6(8-4)10-7(12)11-13/h3,13H,1-2H3,(H2,8,9,10,11,12) |
| InChIKey | HUTKRRUVIXCTKL-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|