C13H22N4O3 — CID 27255463
1-(4,6-dimethoxypyrimidin-2-yl)-3-hexylurea (PubChem CID 27255463) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)-3-hexylurea.
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-hexylurea |
|---|---|
| PubChem CID | 27255463 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-hexylurea |
| SMILES | CCCCCCNC(=O)Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C13H22N4O3/c1-4-5-6-7-8-14-13(18)17-12-15-10(19-2)9-11(16-12)20-3/h9H,4-8H2,1-3H3,(H2,14,15,16,17,18) |
| InChIKey | TUMOSPXRQZRXLH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|