C10H13N3O5 — CID 107624804
4-[(4,6-dimethoxypyrimidin-2-yl)amino]-4-oxobutanoic acid (PubChem CID 107624804) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is 4-[(4,6-dimethoxypyrimidin-2-yl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[(4,6-dimethoxypyrimidin-2-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107624804 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 4-[(4,6-dimethoxypyrimidin-2-yl)amino]-4-oxobutanoic acid |
| SMILES | COc1cc(OC)nc(NC(=O)CCC(=O)O)n1 |
| InChI | InChI=1S/C10H13N3O5/c1-17-7-5-8(18-2)13-10(12-7)11-6(14)3-4-9(15)16/h5H,3-4H2,1-2H3,(H,15,16)(H,11,12,13,14) |
| InChIKey | KVFMMJXZFSACMU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |