C14H16N4O3 — CID 103606554
2-anilino-N-(4,6-dimethoxypyrimidin-2-yl)acetamide (PubChem CID 103606554) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-anilino-N-(4,6-dimethoxypyrimidin-2-yl)acetamide.
| Compound Name | 2-anilino-N-(4,6-dimethoxypyrimidin-2-yl)acetamide |
|---|---|
| PubChem CID | 103606554 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-anilino-N-(4,6-dimethoxypyrimidin-2-yl)acetamide |
| SMILES | COc1cc(OC)nc(NC(=O)CNc2ccccc2)n1 |
| InChI | InChI=1S/C14H16N4O3/c1-20-12-8-13(21-2)18-14(17-12)16-11(19)9-15-10-6-4-3-5-7-10/h3-8,15H,9H2,1-2H3,(H,16,17,18,19) |
| InChIKey | DGXKIMRYAXHEAX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |