C13H13N3O5 — CID 107689719
N-(4,6-dimethoxypyrimidin-2-yl)-2,6-dihydroxybenzamide (PubChem CID 107689719) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is N-(4,6-dimethoxypyrimidin-2-yl)-2,6-dihydroxybenzamide.
| Compound Name | N-(4,6-dimethoxypyrimidin-2-yl)-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 107689719 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-(4,6-dimethoxypyrimidin-2-yl)-2,6-dihydroxybenzamide |
| SMILES | COc1cc(OC)nc(NC(=O)c2c(O)cccc2O)n1 |
| InChI | InChI=1S/C13H13N3O5/c1-20-9-6-10(21-2)15-13(14-9)16-12(19)11-7(17)4-3-5-8(11)18/h3-6,17-18H,1-2H3,(H,14,15,16,19) |
| InChIKey | IWRWRRWTMJLULC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |