C12H13N5O3 — CID 107625756
3-amino-N-(4,6-dimethoxypyrimidin-2-yl)pyridine-2-carboxamide (PubChem CID 107625756) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is 3-amino-N-(4,6-dimethoxypyrimidin-2-yl)pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(4,6-dimethoxypyrimidin-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107625756 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 3-amino-N-(4,6-dimethoxypyrimidin-2-yl)pyridine-2-carboxamide |
| SMILES | COc1cc(OC)nc(NC(=O)c2ncccc2N)n1 |
| InChI | InChI=1S/C12H13N5O3/c1-19-8-6-9(20-2)16-12(15-8)17-11(18)10-7(13)4-3-5-14-10/h3-6H,13H2,1-2H3,(H,15,16,17,18) |
| InChIKey | JJJOPFWZFUNSEL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |