About 3-amino-N-methoxypyridine-2-carboxamide;O-methylhydroxylamine;hydrochloride
3-amino-N-methoxypyridine-2-carboxamide;O-methylhydroxylamine;hydrochloride (PubChem CID 158937226) has the molecular formula C8H15ClN4O3
and a molecular weight of 250.69 g/mol. Its IUPAC name is 3-amino-N-methoxypyridine-2-carboxamide;O-methylhydroxylamine;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-N-methoxypyridine-2-carboxamide;O-methylhydroxylamine;hydrochloride |
| PubChem CID | 158937226 |
| Molecular Formula | C8H15ClN4O3 |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 3-amino-N-methoxypyridine-2-carboxamide;O-methylhydroxylamine;hydrochloride |
| SMILES | CON.CONC(=O)c1ncccc1N.Cl |
| InChI | InChI=1S/C7H9N3O2.CH5NO.ClH/c1-12-10-7(11)6-5(8)3-2-4-9-6;1-3-2;/h2-4H,8H2,1H3,(H,10,11);2H2,1H3;1H |
| InChIKey | OHSBXPYGINMMFJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-methoxypyridine-2-carboxamide;O-methylhydroxylamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-methoxypyridine-2-carboxamide;O-methylhydroxylamine;hydrochloride?
The IUPAC name of 3-amino-N-methoxypyridine-2-carboxamide;O-methylhydroxylamine;hydrochloride (CID 158937226) is 3-amino-N-methoxypyridine-2-carboxamide;O-methylhydroxylamine;hydrochloride.
What is the SMILES notation for 3-amino-N-methoxypyridine-2-carboxamide;O-methylhydroxylamine;hydrochloride?
The canonical SMILES for 3-amino-N-methoxypyridine-2-carboxamide;O-methylhydroxylamine;hydrochloride is CON.CONC(=O)c1ncccc1N.Cl.
What is the InChIKey of 3-amino-N-methoxypyridine-2-carboxamide;O-methylhydroxylamine;hydrochloride?
The InChIKey is OHSBXPYGINMMFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2.CH5NO.ClH/c1-12-10-7(11)6-5(8)3-2-4-9-6;1-3-2;/h2-4H,8H2,1H3,(H,10,11);2H2,1H3;1H.
What are the key properties of 3-amino-N-methoxypyridine-2-carboxamide;O-methylhydroxylamine;hydrochloride?
3-amino-N-methoxypyridine-2-carboxamide;O-methylhydroxylamine;hydrochloride has a molecular weight of 250.69 g/mol, XLogP of -0.12, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-methoxypyridine-2-carboxamide;O-methylhydroxylamine;hydrochloride is sourced from PubChem (CID 158937226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).