About N-(4,6-dimethylpyrimidin-2-yl)-2,6-dihydroxybenzamide
N-(4,6-dimethylpyrimidin-2-yl)-2,6-dihydroxybenzamide (PubChem CID 107688990) has the molecular formula C13H13N3O3
and a molecular weight of 259.27 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-2,6-dihydroxybenzamide.
Molecular Properties
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-2,6-dihydroxybenzamide |
| PubChem CID | 107688990 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-2,6-dihydroxybenzamide |
| SMILES | Cc1cc(C)nc(NC(=O)c2c(O)cccc2O)n1 |
| InChI | InChI=1S/C13H13N3O3/c1-7-6-8(2)15-13(14-7)16-12(19)11-9(17)4-3-5-10(11)18/h3-6,17-18H,1-2H3,(H,14,15,16,19) |
| InChIKey | SPBCWNNZBYFQEO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4,6-dimethylpyrimidin-2-yl)-2,6-dihydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dimethylpyrimidin-2-yl)-2,6-dihydroxybenzamide?
The IUPAC name of N-(4,6-dimethylpyrimidin-2-yl)-2,6-dihydroxybenzamide (CID 107688990) is N-(4,6-dimethylpyrimidin-2-yl)-2,6-dihydroxybenzamide.
What is the SMILES notation for N-(4,6-dimethylpyrimidin-2-yl)-2,6-dihydroxybenzamide?
The canonical SMILES for N-(4,6-dimethylpyrimidin-2-yl)-2,6-dihydroxybenzamide is Cc1cc(C)nc(NC(=O)c2c(O)cccc2O)n1.
What is the InChIKey of N-(4,6-dimethylpyrimidin-2-yl)-2,6-dihydroxybenzamide?
The InChIKey is SPBCWNNZBYFQEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O3/c1-7-6-8(2)15-13(14-7)16-12(19)11-9(17)4-3-5-10(11)18/h3-6,17-18H,1-2H3,(H,14,15,16,19).
What are the key properties of N-(4,6-dimethylpyrimidin-2-yl)-2,6-dihydroxybenzamide?
N-(4,6-dimethylpyrimidin-2-yl)-2,6-dihydroxybenzamide has a molecular weight of 259.27 g/mol, XLogP of 1.76, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dimethylpyrimidin-2-yl)-2,6-dihydroxybenzamide is sourced from PubChem (CID 107688990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).