C17H15N3O — CID 966576
N-(4,6-dimethylpyrimidin-2-yl)naphthalene-1-carboxamide (PubChem CID 966576) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)naphthalene-1-carboxamide.
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 966576 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)naphthalene-1-carboxamide |
| SMILES | Cc1cc(C)nc(NC(=O)c2cccc3ccccc23)n1 |
| InChI | InChI=1S/C17H15N3O/c1-11-10-12(2)19-17(18-11)20-16(21)15-9-5-7-13-6-3-4-8-14(13)15/h3-10H,1-2H3,(H,18,19,20,21) |
| InChIKey | ZEEIVMAMMOXHHH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |