C13H11BrFN3O3 — CID 107626160
2-bromo-N-(4,6-dimethoxypyrimidin-2-yl)-6-fluorobenzamide (PubChem CID 107626160) has the molecular formula C13H11BrFN3O3 and a molecular weight of 356.15 g/mol. Its IUPAC name is 2-bromo-N-(4,6-dimethoxypyrimidin-2-yl)-6-fluorobenzamide.
| Compound Name | 2-bromo-N-(4,6-dimethoxypyrimidin-2-yl)-6-fluorobenzamide |
|---|---|
| PubChem CID | 107626160 |
| Molecular Formula | C13H11BrFN3O3 |
| Molecular Weight | 356.15 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 2-bromo-N-(4,6-dimethoxypyrimidin-2-yl)-6-fluorobenzamide |
| SMILES | COc1cc(OC)nc(NC(=O)c2c(F)cccc2Br)n1 |
| InChI | InChI=1S/C13H11BrFN3O3/c1-20-9-6-10(21-2)17-13(16-9)18-12(19)11-7(14)4-3-5-8(11)15/h3-6H,1-2H3,(H,16,17,18,19) |
| InChIKey | KJDZFOKOLGTZRH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.15 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |