C14H13FN2O4 — CID 67854225
methyl 2-(4,6-dimethoxypyrimidin-2-yl)-6-fluorobenzoate (PubChem CID 67854225) has the molecular formula C14H13FN2O4 and a molecular weight of 292.27 g/mol. Its IUPAC name is methyl 2-(4,6-dimethoxypyrimidin-2-yl)-6-fluorobenzoate.
| Compound Name | methyl 2-(4,6-dimethoxypyrimidin-2-yl)-6-fluorobenzoate |
|---|---|
| PubChem CID | 67854225 |
| Molecular Formula | C14H13FN2O4 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | methyl 2-(4,6-dimethoxypyrimidin-2-yl)-6-fluorobenzoate |
| SMILES | COC(=O)c1c(F)cccc1-c1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C14H13FN2O4/c1-19-10-7-11(20-2)17-13(16-10)8-5-4-6-9(15)12(8)14(18)21-3/h4-7H,1-3H3 |
| InChIKey | LPZSWOYGPVHZQS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |