C14H6Cl5FO2 — CID 134635064
methyl 2-fluoro-6-(2,3,4,5,6-pentachlorophenyl)benzoate (PubChem CID 134635064) has the molecular formula C14H6Cl5FO2 and a molecular weight of 402.46 g/mol. Its IUPAC name is methyl 2-fluoro-6-(2,3,4,5,6-pentachlorophenyl)benzoate.
| Compound Name | methyl 2-fluoro-6-(2,3,4,5,6-pentachlorophenyl)benzoate |
|---|---|
| PubChem CID | 134635064 |
| Molecular Formula | C14H6Cl5FO2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 399.88 |
| IUPAC Name | methyl 2-fluoro-6-(2,3,4,5,6-pentachlorophenyl)benzoate |
| SMILES | COC(=O)c1c(F)cccc1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H6Cl5FO2/c1-22-14(21)7-5(3-2-4-6(7)20)8-9(15)11(17)13(19)12(18)10(8)16/h2-4H,1H3 |
| InChIKey | FEHVQUWFBQJHPF-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|