C14H8Cl2F2O2 — CID 119016274
methyl 2-(2,3-dichlorophenyl)-4,5-difluorobenzoate (PubChem CID 119016274) has the molecular formula C14H8Cl2F2O2 and a molecular weight of 317.12 g/mol. Its IUPAC name is methyl 2-(2,3-dichlorophenyl)-4,5-difluorobenzoate.
| Compound Name | methyl 2-(2,3-dichlorophenyl)-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 119016274 |
| Molecular Formula | C14H8Cl2F2O2 |
| Molecular Weight | 317.12 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | methyl 2-(2,3-dichlorophenyl)-4,5-difluorobenzoate |
| SMILES | COC(=O)c1cc(F)c(F)cc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H8Cl2F2O2/c1-20-14(19)9-6-12(18)11(17)5-8(9)7-3-2-4-10(15)13(7)16/h2-6H,1H3 |
| InChIKey | RZMVGIFDIYFEEM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.12 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |