C16H11Cl2F2NO4 — CID 169223403
methyl 2-[(2,3-dichlorophenyl)methoxycarbonylamino]-4,5-difluorobenzoate (PubChem CID 169223403) has the molecular formula C16H11Cl2F2NO4 and a molecular weight of 390.17 g/mol. Its IUPAC name is methyl 2-[(2,3-dichlorophenyl)methoxycarbonylamino]-4,5-difluorobenzoate.
| Compound Name | methyl 2-[(2,3-dichlorophenyl)methoxycarbonylamino]-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 169223403 |
| Molecular Formula | C16H11Cl2F2NO4 |
| Molecular Weight | 390.17 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | methyl 2-[(2,3-dichlorophenyl)methoxycarbonylamino]-4,5-difluorobenzoate |
| SMILES | COC(=O)c1cc(F)c(F)cc1NC(=O)OCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H11Cl2F2NO4/c1-24-15(22)9-5-11(19)12(20)6-13(9)21-16(23)25-7-8-3-2-4-10(17)14(8)18/h2-6H,7H2,1H3,(H,21,23) |
| InChIKey | ZMHODSRLFUXIOM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.17 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |