C17H15F2NO4 — CID 169223401
methyl 4,5-difluoro-2-[(4-methylphenyl)methoxycarbonylamino]benzoate (PubChem CID 169223401) has the molecular formula C17H15F2NO4 and a molecular weight of 335.31 g/mol. Its IUPAC name is methyl 4,5-difluoro-2-[(4-methylphenyl)methoxycarbonylamino]benzoate.
| Compound Name | methyl 4,5-difluoro-2-[(4-methylphenyl)methoxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 169223401 |
| Molecular Formula | C17H15F2NO4 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | methyl 4,5-difluoro-2-[(4-methylphenyl)methoxycarbonylamino]benzoate |
| SMILES | COC(=O)c1cc(F)c(F)cc1NC(=O)OCc1ccc(C)cc1 |
| InChI | InChI=1S/C17H15F2NO4/c1-10-3-5-11(6-4-10)9-24-17(22)20-15-8-14(19)13(18)7-12(15)16(21)23-2/h3-8H,9H2,1-2H3,(H,20,22) |
| InChIKey | HDCYMCQXYCTASN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |