C19H22N2O6 — CID 11014212
ethyl 2-[(4-aminophenyl)methoxycarbonylamino]-4,5-dimethoxybenzoate (PubChem CID 11014212) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is ethyl 2-[(4-aminophenyl)methoxycarbonylamino]-4,5-dimethoxybenzoate.
| Compound Name | ethyl 2-[(4-aminophenyl)methoxycarbonylamino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 11014212 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | ethyl 2-[(4-aminophenyl)methoxycarbonylamino]-4,5-dimethoxybenzoate |
| SMILES | CCOC(=O)c1cc(OC)c(OC)cc1NC(=O)OCc1ccc(N)cc1 |
| InChI | InChI=1S/C19H22N2O6/c1-4-26-18(22)14-9-16(24-2)17(25-3)10-15(14)21-19(23)27-11-12-5-7-13(20)8-6-12/h5-10H,4,11,20H2,1-3H3,(H,21,23) |
| InChIKey | SVJUUKKJFUHXQF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|