C19H20O7 — CID 2488136
(4-methoxycarbonylphenyl)methyl 2,4,5-trimethoxybenzoate (PubChem CID 2488136) has the molecular formula C19H20O7 and a molecular weight of 360.36 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl)methyl 2,4,5-trimethoxybenzoate.
| Compound Name | (4-methoxycarbonylphenyl)methyl 2,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 2488136 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (4-methoxycarbonylphenyl)methyl 2,4,5-trimethoxybenzoate |
| SMILES | COC(=O)c1ccc(COC(=O)c2cc(OC)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C19H20O7/c1-22-15-10-17(24-3)16(23-2)9-14(15)19(21)26-11-12-5-7-13(8-6-12)18(20)25-4/h5-10H,11H2,1-4H3 |
| InChIKey | DCHVYQKQTWEVMH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |