C14H8F4O2 — CID 134635154
methyl 2-(2,3-difluorophenyl)-4,5-difluorobenzoate (PubChem CID 134635154) has the molecular formula C14H8F4O2 and a molecular weight of 284.21 g/mol. Its IUPAC name is methyl 2-(2,3-difluorophenyl)-4,5-difluorobenzoate.
| Compound Name | methyl 2-(2,3-difluorophenyl)-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 134635154 |
| Molecular Formula | C14H8F4O2 |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | methyl 2-(2,3-difluorophenyl)-4,5-difluorobenzoate |
| SMILES | COC(=O)c1cc(F)c(F)cc1-c1cccc(F)c1F |
| InChI | InChI=1S/C14H8F4O2/c1-20-14(19)9-6-12(17)11(16)5-8(9)7-3-2-4-10(15)13(7)18/h2-6H,1H3 |
| InChIKey | QDNALSMWWQJWKD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |