C15H9F5O2 — CID 118835382
methyl 4,5-difluoro-2-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 118835382) has the molecular formula C15H9F5O2 and a molecular weight of 316.23 g/mol. Its IUPAC name is methyl 4,5-difluoro-2-[4-(trifluoromethyl)phenyl]benzoate.
| Compound Name | methyl 4,5-difluoro-2-[4-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 118835382 |
| Molecular Formula | C15H9F5O2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | methyl 4,5-difluoro-2-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | COC(=O)c1cc(F)c(F)cc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H9F5O2/c1-22-14(21)11-7-13(17)12(16)6-10(11)8-2-4-9(5-3-8)15(18,19)20/h2-7H,1H3 |
| InChIKey | FRJQHJDYBVYIDN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |