C22H20F2O3S — CID 155683775
methyl 2-[3-(2,3-difluorophenyl)-5-(3-methoxypropyl)thiophen-2-yl]benzoate (PubChem CID 155683775) has the molecular formula C22H20F2O3S and a molecular weight of 402.46 g/mol. Its IUPAC name is methyl 2-[3-(2,3-difluorophenyl)-5-(3-methoxypropyl)thiophen-2-yl]benzoate.
| Compound Name | methyl 2-[3-(2,3-difluorophenyl)-5-(3-methoxypropyl)thiophen-2-yl]benzoate |
|---|---|
| PubChem CID | 155683775 |
| Molecular Formula | C22H20F2O3S |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | methyl 2-[3-(2,3-difluorophenyl)-5-(3-methoxypropyl)thiophen-2-yl]benzoate |
| SMILES | COCCCc1cc(-c2cccc(F)c2F)c(-c2ccccc2C(=O)OC)s1 |
| InChI | InChI=1S/C22H20F2O3S/c1-26-12-6-7-14-13-18(15-10-5-11-19(23)20(15)24)21(28-14)16-8-3-4-9-17(16)22(25)27-2/h3-5,8-11,13H,6-7,12H2,1-2H3 |
| InChIKey | FKCMIQMJFNXZNC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|