C11H14F2N2O2 — CID 106180175
N-(1-amino-3-methoxypropan-2-yl)-2,3-difluorobenzamide (PubChem CID 106180175) has the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. Its IUPAC name is N-(1-amino-3-methoxypropan-2-yl)-2,3-difluorobenzamide.
| Compound Name | N-(1-amino-3-methoxypropan-2-yl)-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 106180175 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-(1-amino-3-methoxypropan-2-yl)-2,3-difluorobenzamide |
| SMILES | COCC(CN)NC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C11H14F2N2O2/c1-17-6-7(5-14)15-11(16)8-3-2-4-9(12)10(8)13/h2-4,7H,5-6,14H2,1H3,(H,15,16) |
| InChIKey | HBBVPLXVASAZLQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |