C11H12BrF2NO2 — CID 106183792
N-(1-bromo-3-methoxypropan-2-yl)-2,3-difluorobenzamide (PubChem CID 106183792) has the molecular formula C11H12BrF2NO2 and a molecular weight of 308.12 g/mol. Its IUPAC name is N-(1-bromo-3-methoxypropan-2-yl)-2,3-difluorobenzamide.
| Compound Name | N-(1-bromo-3-methoxypropan-2-yl)-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 106183792 |
| Molecular Formula | C11H12BrF2NO2 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | N-(1-bromo-3-methoxypropan-2-yl)-2,3-difluorobenzamide |
| SMILES | COCC(CBr)NC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C11H12BrF2NO2/c1-17-6-7(5-12)15-11(16)8-3-2-4-9(13)10(8)14/h2-4,7H,5-6H2,1H3,(H,15,16) |
| InChIKey | RMQARGPRFCNROW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|