C12H16BrNO4 — CID 114211990
N-(1-bromo-4-methoxybutan-2-yl)-2,3-dihydroxybenzamide (PubChem CID 114211990) has the molecular formula C12H16BrNO4 and a molecular weight of 318.17 g/mol. Its IUPAC name is N-(1-bromo-4-methoxybutan-2-yl)-2,3-dihydroxybenzamide.
| Compound Name | N-(1-bromo-4-methoxybutan-2-yl)-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114211990 |
| Molecular Formula | C12H16BrNO4 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | N-(1-bromo-4-methoxybutan-2-yl)-2,3-dihydroxybenzamide |
| SMILES | COCCC(CBr)NC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C12H16BrNO4/c1-18-6-5-8(7-13)14-12(17)9-3-2-4-10(15)11(9)16/h2-4,8,15-16H,5-7H2,1H3,(H,14,17) |
| InChIKey | VDWXDXMVAPLBLH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|