About N-(4,6-dimethoxypyrimidin-2-yl)-N'-[(3-ethylsulfonyl-2-pyridinyl)sulfonyl]carbamimidate
N-(4,6-dimethoxypyrimidin-2-yl)-N'-[(3-ethylsulfonyl-2-pyridinyl)sulfonyl]carbamimidate (PubChem CID 51380908) has the molecular formula C14H16N5O7S2-
and a molecular weight of 430.44 g/mol. Its IUPAC name is N-(4,6-dimethoxypyrimidin-2-yl)-N'-[(3-ethylsulfonyl-2-pyridinyl)sulfonyl]carbamimidate.
Molecular Properties
| Compound Name | N-(4,6-dimethoxypyrimidin-2-yl)-N'-[(3-ethylsulfonyl-2-pyridinyl)sulfonyl]carbamimidate |
| PubChem CID | 51380908 |
| Molecular Formula | C14H16N5O7S2- |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | N-(4,6-dimethoxypyrimidin-2-yl)-N'-[(3-ethylsulfonyl-2-pyridinyl)sulfonyl]carbamimidate |
| SMILES | CCS(=O)(=O)c1cccnc1S(=O)(=O)N=C([O-])Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C14H17N5O7S2/c1-4-27(21,22)9-6-5-7-15-12(9)28(23,24)19-14(20)18-13-16-10(25-2)8-11(17-13)26-3/h5-8H,4H2,1-3H3,(H2,16,17,18,19,20)/p-1 |
| InChIKey | MEFOUWRMVYJCQC-UHFFFAOYSA-M |
| XLogP | -0.80 |
| TPSA | 172.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4,6-dimethoxypyrimidin-2-yl)-N'-[(3-ethylsulfonyl-2-pyridinyl)sulfonyl]carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dimethoxypyrimidin-2-yl)-N'-[(3-ethylsulfonyl-2-pyridinyl)sulfonyl]carbamimidate?
The IUPAC name of N-(4,6-dimethoxypyrimidin-2-yl)-N'-[(3-ethylsulfonyl-2-pyridinyl)sulfonyl]carbamimidate (CID 51380908) is N-(4,6-dimethoxypyrimidin-2-yl)-N'-[(3-ethylsulfonyl-2-pyridinyl)sulfonyl]carbamimidate.
What is the SMILES notation for N-(4,6-dimethoxypyrimidin-2-yl)-N'-[(3-ethylsulfonyl-2-pyridinyl)sulfonyl]carbamimidate?
The canonical SMILES for N-(4,6-dimethoxypyrimidin-2-yl)-N'-[(3-ethylsulfonyl-2-pyridinyl)sulfonyl]carbamimidate is CCS(=O)(=O)c1cccnc1S(=O)(=O)N=C([O-])Nc1nc(OC)cc(OC)n1.
What is the InChIKey of N-(4,6-dimethoxypyrimidin-2-yl)-N'-[(3-ethylsulfonyl-2-pyridinyl)sulfonyl]carbamimidate?
The InChIKey is MEFOUWRMVYJCQC-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H17N5O7S2/c1-4-27(21,22)9-6-5-7-15-12(9)28(23,24)19-14(20)18-13-16-10(25-2)8-11(17-13)26-3/h5-8H,4H2,1-3H3,(H2,16,17,18,19,20)/p-1.
What are the key properties of N-(4,6-dimethoxypyrimidin-2-yl)-N'-[(3-ethylsulfonyl-2-pyridinyl)sulfonyl]carbamimidate?
N-(4,6-dimethoxypyrimidin-2-yl)-N'-[(3-ethylsulfonyl-2-pyridinyl)sulfonyl]carbamimidate has a molecular weight of 430.44 g/mol, XLogP of -0.80, 7 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dimethoxypyrimidin-2-yl)-N'-[(3-ethylsulfonyl-2-pyridinyl)sulfonyl]carbamimidate is sourced from PubChem (CID 51380908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).