C11H11ClN4O4S — CID 104599417
2-chloro-N-(4,6-dimethoxypyrimidin-2-yl)pyridine-3-sulfonamide (PubChem CID 104599417) has the molecular formula C11H11ClN4O4S and a molecular weight of 330.75 g/mol. Its IUPAC name is 2-chloro-N-(4,6-dimethoxypyrimidin-2-yl)pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(4,6-dimethoxypyrimidin-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 104599417 |
| Molecular Formula | C11H11ClN4O4S |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 2-chloro-N-(4,6-dimethoxypyrimidin-2-yl)pyridine-3-sulfonamide |
| SMILES | COc1cc(OC)nc(NS(=O)(=O)c2cccnc2Cl)n1 |
| InChI | InChI=1S/C11H11ClN4O4S/c1-19-8-6-9(20-2)15-11(14-8)16-21(17,18)7-4-3-5-13-10(7)12/h3-6H,1-2H3,(H,14,15,16) |
| InChIKey | KQYQHSFRIKAPBM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|