C13H21ClN2O2S — CID 61046080
2-chloro-N-(2,4,4-trimethylpentan-2-yl)pyridine-3-sulfonamide (PubChem CID 61046080) has the molecular formula C13H21ClN2O2S and a molecular weight of 304.84 g/mol. Its IUPAC name is 2-chloro-N-(2,4,4-trimethylpentan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(2,4,4-trimethylpentan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61046080 |
| Molecular Formula | C13H21ClN2O2S |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-chloro-N-(2,4,4-trimethylpentan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC(C)(C)CC(C)(C)NS(=O)(=O)c1cccnc1Cl |
| InChI | InChI=1S/C13H21ClN2O2S/c1-12(2,3)9-13(4,5)16-19(17,18)10-7-6-8-15-11(10)14/h6-8,16H,9H2,1-5H3 |
| InChIKey | PJCLPBUEQKJPFG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|