C14H20Cl3NO2S — CID 50876740
2,3,4-trichloro-N-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide (PubChem CID 50876740) has the molecular formula C14H20Cl3NO2S and a molecular weight of 372.75 g/mol. Its IUPAC name is 2,3,4-trichloro-N-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide.
| Compound Name | 2,3,4-trichloro-N-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 50876740 |
| Molecular Formula | C14H20Cl3NO2S |
| Molecular Weight | 372.75 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 2,3,4-trichloro-N-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide |
| SMILES | CC(C)(C)CC(C)(C)NS(=O)(=O)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H20Cl3NO2S/c1-13(2,3)8-14(4,5)18-21(19,20)10-7-6-9(15)11(16)12(10)17/h6-7,18H,8H2,1-5H3 |
| InChIKey | RMPMVPUIQKAJAN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.75 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|