C11H13Cl2NO4S — CID 16771513
3-(tert-butylsulfamoyl)-2,6-dichlorobenzoic acid (PubChem CID 16771513) has the molecular formula C11H13Cl2NO4S and a molecular weight of 326.20 g/mol. Its IUPAC name is 3-(tert-butylsulfamoyl)-2,6-dichlorobenzoic acid.
| Compound Name | 3-(tert-butylsulfamoyl)-2,6-dichlorobenzoic acid |
|---|---|
| PubChem CID | 16771513 |
| Molecular Formula | C11H13Cl2NO4S |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 3-(tert-butylsulfamoyl)-2,6-dichlorobenzoic acid |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1Cl |
| InChI | InChI=1S/C11H13Cl2NO4S/c1-11(2,3)14-19(17,18)7-5-4-6(12)8(9(7)13)10(15)16/h4-5,14H,1-3H3,(H,15,16) |
| InChIKey | ROLAZNXEYYTTLU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |