2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid

C10H10Cl2O5S — CID 65277506

IUPAC2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid
SMILESCC(O)CS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1Cl
InChIInChI=1S/C10H10Cl2O5S/c1-5(13)4-18(16,17)7-3-2-6(11)8(9(7)12)10(14)15/h2-3,5,13H,4H2,1H3,(H,14,15)
InChIKeyQVBCWXZUAJUKPB-UHFFFAOYSA-N
MW313.16 g/mol
LogP1.85
Rot. Bonds4

About 2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid

2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid (PubChem CID 65277506) has the molecular formula C10H10Cl2O5S and a molecular weight of 313.16 g/mol. Its IUPAC name is 2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid.

Molecular Properties

Compound Name2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid
PubChem CID65277506
Molecular FormulaC10H10Cl2O5S
Molecular Weight313.16 g/mol
Exact Mass311.96
IUPAC Name2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid
SMILESCC(O)CS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1Cl
InChIInChI=1S/C10H10Cl2O5S/c1-5(13)4-18(16,17)7-3-2-6(11)8(9(7)12)10(14)15/h2-3,5,13H,4H2,1H3,(H,14,15)
InChIKeyQVBCWXZUAJUKPB-UHFFFAOYSA-N
XLogP1.85
TPSA91.67 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.16
LogP ≤ 51.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid?
The IUPAC name of 2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid (CID 65277506) is 2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid.
What is the SMILES notation for 2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid?
The canonical SMILES for 2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid is CC(O)CS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1Cl.
What is the InChIKey of 2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid?
The InChIKey is QVBCWXZUAJUKPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2O5S/c1-5(13)4-18(16,17)7-3-2-6(11)8(9(7)12)10(14)15/h2-3,5,13H,4H2,1H3,(H,14,15).
What are the key properties of 2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid?
2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid has a molecular weight of 313.16 g/mol, XLogP of 1.85, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid is sourced from PubChem (CID 65277506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).