C10H10Cl2O5S — CID 65277506
2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid (PubChem CID 65277506) has the molecular formula C10H10Cl2O5S and a molecular weight of 313.16 g/mol. Its IUPAC name is 2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid.
| Compound Name | 2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 65277506 |
| Molecular Formula | C10H10Cl2O5S |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | 2,6-dichloro-3-(2-hydroxypropylsulfonyl)benzoic acid |
| SMILES | CC(O)CS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1Cl |
| InChI | InChI=1S/C10H10Cl2O5S/c1-5(13)4-18(16,17)7-3-2-6(11)8(9(7)12)10(14)15/h2-3,5,13H,4H2,1H3,(H,14,15) |
| InChIKey | QVBCWXZUAJUKPB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |