C13H17Cl2NO4S — CID 43274410
3-[butan-2-yl(ethyl)sulfamoyl]-2,6-dichlorobenzoic acid (PubChem CID 43274410) has the molecular formula C13H17Cl2NO4S and a molecular weight of 354.26 g/mol. Its IUPAC name is 3-[butan-2-yl(ethyl)sulfamoyl]-2,6-dichlorobenzoic acid.
| Compound Name | 3-[butan-2-yl(ethyl)sulfamoyl]-2,6-dichlorobenzoic acid |
|---|---|
| PubChem CID | 43274410 |
| Molecular Formula | C13H17Cl2NO4S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 3-[butan-2-yl(ethyl)sulfamoyl]-2,6-dichlorobenzoic acid |
| SMILES | CCC(C)N(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)O)c1Cl |
| InChI | InChI=1S/C13H17Cl2NO4S/c1-4-8(3)16(5-2)21(19,20)10-7-6-9(14)11(12(10)15)13(17)18/h6-8H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | XOUFPWZWSINXEC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |