C11H10Cl2N2O4S — CID 62668420
2,6-dichloro-3-(2-cyanopropylsulfamoyl)benzoic acid (PubChem CID 62668420) has the molecular formula C11H10Cl2N2O4S and a molecular weight of 337.18 g/mol. Its IUPAC name is 2,6-dichloro-3-(2-cyanopropylsulfamoyl)benzoic acid.
| Compound Name | 2,6-dichloro-3-(2-cyanopropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 62668420 |
| Molecular Formula | C11H10Cl2N2O4S |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 2,6-dichloro-3-(2-cyanopropylsulfamoyl)benzoic acid |
| SMILES | CC(C#N)CNS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1Cl |
| InChI | InChI=1S/C11H10Cl2N2O4S/c1-6(4-14)5-15-20(18,19)8-3-2-7(12)9(10(8)13)11(16)17/h2-3,6,15H,5H2,1H3,(H,16,17) |
| InChIKey | SGECLBPCMIJIHL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |