C11H9Cl2NO4S — CID 43140764
2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid (PubChem CID 43140764) has the molecular formula C11H9Cl2NO4S and a molecular weight of 322.17 g/mol. Its IUPAC name is 2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid.
| Compound Name | 2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 43140764 |
| Molecular Formula | C11H9Cl2NO4S |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid |
| SMILES | N#CCCCS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1Cl |
| InChI | InChI=1S/C11H9Cl2NO4S/c12-7-3-4-8(10(13)9(7)11(15)16)19(17,18)6-2-1-5-14/h3-4H,1-2,6H2,(H,15,16) |
| InChIKey | YRIMDGJXFICQLU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|