2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid

C11H9Cl2NO4S — CID 43140764

IUPAC2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid
SMILESN#CCCCS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1Cl
InChIInChI=1S/C11H9Cl2NO4S/c12-7-3-4-8(10(13)9(7)11(15)16)19(17,18)6-2-1-5-14/h3-4H,1-2,6H2,(H,15,16)
InChIKeyYRIMDGJXFICQLU-UHFFFAOYSA-N
MW322.17 g/mol
LogP2.77
Rot. Bonds5

About 2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid

2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid (PubChem CID 43140764) has the molecular formula C11H9Cl2NO4S and a molecular weight of 322.17 g/mol. Its IUPAC name is 2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid.

Molecular Properties

Compound Name2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid
PubChem CID43140764
Molecular FormulaC11H9Cl2NO4S
Molecular Weight322.17 g/mol
Exact Mass320.96
IUPAC Name2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid
SMILESN#CCCCS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1Cl
InChIInChI=1S/C11H9Cl2NO4S/c12-7-3-4-8(10(13)9(7)11(15)16)19(17,18)6-2-1-5-14/h3-4H,1-2,6H2,(H,15,16)
InChIKeyYRIMDGJXFICQLU-UHFFFAOYSA-N
XLogP2.77
TPSA95.23 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500322.17
LogP ≤ 52.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid?
The IUPAC name of 2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid (CID 43140764) is 2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid.
What is the SMILES notation for 2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid?
The canonical SMILES for 2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid is N#CCCCS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1Cl.
What is the InChIKey of 2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid?
The InChIKey is YRIMDGJXFICQLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2NO4S/c12-7-3-4-8(10(13)9(7)11(15)16)19(17,18)6-2-1-5-14/h3-4H,1-2,6H2,(H,15,16).
What are the key properties of 2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid?
2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid has a molecular weight of 322.17 g/mol, XLogP of 2.77, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-3-(3-cyanopropylsulfonyl)benzoic acid is sourced from PubChem (CID 43140764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).