C11H11Cl2NO4S — CID 43247630
2,6-dichloro-3-[cyclopropyl(methyl)sulfamoyl]benzoic acid (PubChem CID 43247630) has the molecular formula C11H11Cl2NO4S and a molecular weight of 324.19 g/mol. Its IUPAC name is 2,6-dichloro-3-[cyclopropyl(methyl)sulfamoyl]benzoic acid.
| Compound Name | 2,6-dichloro-3-[cyclopropyl(methyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 43247630 |
| Molecular Formula | C11H11Cl2NO4S |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 2,6-dichloro-3-[cyclopropyl(methyl)sulfamoyl]benzoic acid |
| SMILES | CN(C1CC1)S(=O)(=O)c1ccc(Cl)c(C(=O)O)c1Cl |
| InChI | InChI=1S/C11H11Cl2NO4S/c1-14(6-2-3-6)19(17,18)8-5-4-7(12)9(10(8)13)11(15)16/h4-6H,2-3H2,1H3,(H,15,16) |
| InChIKey | XQWYOVKGSWNWOC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |