C11H9Cl2N3O4S — CID 63821892
2,6-dichloro-3-[(5-methyl-1H-pyrazol-3-yl)sulfamoyl]benzoic acid (PubChem CID 63821892) has the molecular formula C11H9Cl2N3O4S and a molecular weight of 350.18 g/mol. Its IUPAC name is 2,6-dichloro-3-[(5-methyl-1H-pyrazol-3-yl)sulfamoyl]benzoic acid.
| Compound Name | 2,6-dichloro-3-[(5-methyl-1H-pyrazol-3-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 63821892 |
| Molecular Formula | C11H9Cl2N3O4S |
| Molecular Weight | 350.18 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 2,6-dichloro-3-[(5-methyl-1H-pyrazol-3-yl)sulfamoyl]benzoic acid |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(Cl)c(C(=O)O)c2Cl)n[nH]1 |
| InChI | InChI=1S/C11H9Cl2N3O4S/c1-5-4-8(15-14-5)16-21(19,20)7-3-2-6(12)9(10(7)13)11(17)18/h2-4H,1H3,(H,17,18)(H2,14,15,16) |
| InChIKey | DDLMKEQTZDFCNI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.18 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |