C10H9F2N3O2S — CID 63823168
2,5-difluoro-N-(5-methyl-1H-pyrazol-3-yl)benzenesulfonamide (PubChem CID 63823168) has the molecular formula C10H9F2N3O2S and a molecular weight of 273.26 g/mol. Its IUPAC name is 2,5-difluoro-N-(5-methyl-1H-pyrazol-3-yl)benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-(5-methyl-1H-pyrazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 63823168 |
| Molecular Formula | C10H9F2N3O2S |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2,5-difluoro-N-(5-methyl-1H-pyrazol-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(F)ccc2F)n[nH]1 |
| InChI | InChI=1S/C10H9F2N3O2S/c1-6-4-10(14-13-6)15-18(16,17)9-5-7(11)2-3-8(9)12/h2-5H,1H3,(H2,13,14,15) |
| InChIKey | GKKKSWYKZDHXAB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |