C14H25NO2S2 — CID 60530946
5-ethyl-N-(2,4,4-trimethylpentan-2-yl)thiophene-2-sulfonamide (PubChem CID 60530946) has the molecular formula C14H25NO2S2 and a molecular weight of 303.49 g/mol. Its IUPAC name is 5-ethyl-N-(2,4,4-trimethylpentan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-(2,4,4-trimethylpentan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 60530946 |
| Molecular Formula | C14H25NO2S2 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 5-ethyl-N-(2,4,4-trimethylpentan-2-yl)thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NC(C)(C)CC(C)(C)C)s1 |
| InChI | InChI=1S/C14H25NO2S2/c1-7-11-8-9-12(18-11)19(16,17)15-14(5,6)10-13(2,3)4/h8-9,15H,7,10H2,1-6H3 |
| InChIKey | WKCFFDNZMJUMRU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |