C15H18BrNO2S2 — CID 105060223
N-(1-bromo-2-phenylpropan-2-yl)-5-ethylthiophene-2-sulfonamide (PubChem CID 105060223) has the molecular formula C15H18BrNO2S2 and a molecular weight of 388.35 g/mol. Its IUPAC name is N-(1-bromo-2-phenylpropan-2-yl)-5-ethylthiophene-2-sulfonamide.
| Compound Name | N-(1-bromo-2-phenylpropan-2-yl)-5-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 105060223 |
| Molecular Formula | C15H18BrNO2S2 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | N-(1-bromo-2-phenylpropan-2-yl)-5-ethylthiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NC(C)(CBr)c2ccccc2)s1 |
| InChI | InChI=1S/C15H18BrNO2S2/c1-3-13-9-10-14(20-13)21(18,19)17-15(2,11-16)12-7-5-4-6-8-12/h4-10,17H,3,11H2,1-2H3 |
| InChIKey | IIKYNIARUQCUEN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|