C15H19NO3S2 — CID 110664046
5-ethyl-N-(2-hydroxy-2-phenylpropyl)thiophene-2-sulfonamide (PubChem CID 110664046) has the molecular formula C15H19NO3S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 5-ethyl-N-(2-hydroxy-2-phenylpropyl)thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-(2-hydroxy-2-phenylpropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110664046 |
| Molecular Formula | C15H19NO3S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 5-ethyl-N-(2-hydroxy-2-phenylpropyl)thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCC(C)(O)c2ccccc2)s1 |
| InChI | InChI=1S/C15H19NO3S2/c1-3-13-9-10-14(20-13)21(18,19)16-11-15(2,17)12-7-5-4-6-8-12/h4-10,16-17H,3,11H2,1-2H3 |
| InChIKey | GZOOZWDXHNVNRS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |