C12H21NO2S2 — CID 115613311
5-ethyl-N-(2-ethylbutyl)thiophene-2-sulfonamide (PubChem CID 115613311) has the molecular formula C12H21NO2S2 and a molecular weight of 275.44 g/mol. Its IUPAC name is 5-ethyl-N-(2-ethylbutyl)thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-(2-ethylbutyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 115613311 |
| Molecular Formula | C12H21NO2S2 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 5-ethyl-N-(2-ethylbutyl)thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCC(CC)CC)s1 |
| InChI | InChI=1S/C12H21NO2S2/c1-4-10(5-2)9-13-17(14,15)12-8-7-11(6-3)16-12/h7-8,10,13H,4-6,9H2,1-3H3 |
| InChIKey | PYPYKUJATOQFCD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |