C11H19NO3S2 — CID 110602852
5-ethyl-N-(2-propan-2-yloxyethyl)thiophene-2-sulfonamide (PubChem CID 110602852) has the molecular formula C11H19NO3S2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 5-ethyl-N-(2-propan-2-yloxyethyl)thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-(2-propan-2-yloxyethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110602852 |
| Molecular Formula | C11H19NO3S2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 5-ethyl-N-(2-propan-2-yloxyethyl)thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCOC(C)C)s1 |
| InChI | InChI=1S/C11H19NO3S2/c1-4-10-5-6-11(16-10)17(13,14)12-7-8-15-9(2)3/h5-6,9,12H,4,7-8H2,1-3H3 |
| InChIKey | VDSZFVQVROZHJZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|