C16H21NO3S2 — CID 113100868
N-[2-(2,5-dimethylphenoxy)ethyl]-5-ethylthiophene-2-sulfonamide (PubChem CID 113100868) has the molecular formula C16H21NO3S2 and a molecular weight of 339.48 g/mol. Its IUPAC name is N-[2-(2,5-dimethylphenoxy)ethyl]-5-ethylthiophene-2-sulfonamide.
| Compound Name | N-[2-(2,5-dimethylphenoxy)ethyl]-5-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113100868 |
| Molecular Formula | C16H21NO3S2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-[2-(2,5-dimethylphenoxy)ethyl]-5-ethylthiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCOc2cc(C)ccc2C)s1 |
| InChI | InChI=1S/C16H21NO3S2/c1-4-14-7-8-16(21-14)22(18,19)17-9-10-20-15-11-12(2)5-6-13(15)3/h5-8,11,17H,4,9-10H2,1-3H3 |
| InChIKey | FKPJRDNOCDTOAD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|