C12H19NO3S — CID 113100852
N-[2-(2,5-dimethylphenoxy)ethyl]ethanesulfonamide (PubChem CID 113100852) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is N-[2-(2,5-dimethylphenoxy)ethyl]ethanesulfonamide.
| Compound Name | N-[2-(2,5-dimethylphenoxy)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 113100852 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-[2-(2,5-dimethylphenoxy)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C12H19NO3S/c1-4-17(14,15)13-7-8-16-12-9-10(2)5-6-11(12)3/h5-6,9,13H,4,7-8H2,1-3H3 |
| InChIKey | XSNMSWNGIIZFKI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|