C13H20O3S — CID 106732643
1,4-dimethyl-2-(2-propan-2-ylsulfonylethoxy)benzene (PubChem CID 106732643) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1,4-dimethyl-2-(2-propan-2-ylsulfonylethoxy)benzene.
| Compound Name | 1,4-dimethyl-2-(2-propan-2-ylsulfonylethoxy)benzene |
|---|---|
| PubChem CID | 106732643 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1,4-dimethyl-2-(2-propan-2-ylsulfonylethoxy)benzene |
| SMILES | Cc1ccc(C)c(OCCS(=O)(=O)C(C)C)c1 |
| InChI | InChI=1S/C13H20O3S/c1-10(2)17(14,15)8-7-16-13-9-11(3)5-6-12(13)4/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | VXRBJPBDBGZQEE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |