C12H19NO2S — CID 47429985
N-[2-(2,4-dimethylphenyl)ethyl]ethanesulfonamide (PubChem CID 47429985) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is N-[2-(2,4-dimethylphenyl)ethyl]ethanesulfonamide.
| Compound Name | N-[2-(2,4-dimethylphenyl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 47429985 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-[2-(2,4-dimethylphenyl)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCc1ccc(C)cc1C |
| InChI | InChI=1S/C12H19NO2S/c1-4-16(14,15)13-8-7-12-6-5-10(2)9-11(12)3/h5-6,9,13H,4,7-8H2,1-3H3 |
| InChIKey | UITZJLXGAOIFLY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |