C13H21NO3S — CID 110788053
N-[2-(2-methoxy-4,5-dimethylphenyl)ethyl]ethanesulfonamide (PubChem CID 110788053) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is N-[2-(2-methoxy-4,5-dimethylphenyl)ethyl]ethanesulfonamide.
| Compound Name | N-[2-(2-methoxy-4,5-dimethylphenyl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 110788053 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-[2-(2-methoxy-4,5-dimethylphenyl)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCc1cc(C)c(C)cc1OC |
| InChI | InChI=1S/C13H21NO3S/c1-5-18(15,16)14-7-6-12-8-10(2)11(3)9-13(12)17-4/h8-9,14H,5-7H2,1-4H3 |
| InChIKey | RZPBKASEYBWFRM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |