C16H27NO3S — CID 110788400
N-[2-(5-tert-butyl-4-methoxy-2-methylphenyl)ethyl]ethanesulfonamide (PubChem CID 110788400) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is N-[2-(5-tert-butyl-4-methoxy-2-methylphenyl)ethyl]ethanesulfonamide.
| Compound Name | N-[2-(5-tert-butyl-4-methoxy-2-methylphenyl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 110788400 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-[2-(5-tert-butyl-4-methoxy-2-methylphenyl)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCc1cc(C(C)(C)C)c(OC)cc1C |
| InChI | InChI=1S/C16H27NO3S/c1-7-21(18,19)17-9-8-13-11-14(16(3,4)5)15(20-6)10-12(13)2/h10-11,17H,7-9H2,1-6H3 |
| InChIKey | LDNZGITVUYXHGT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |