C15H25NO2S — CID 110787933
N-[2-(5-tert-butyl-2-methylphenyl)ethyl]ethanesulfonamide (PubChem CID 110787933) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is N-[2-(5-tert-butyl-2-methylphenyl)ethyl]ethanesulfonamide.
| Compound Name | N-[2-(5-tert-butyl-2-methylphenyl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 110787933 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-[2-(5-tert-butyl-2-methylphenyl)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCc1cc(C(C)(C)C)ccc1C |
| InChI | InChI=1S/C15H25NO2S/c1-6-19(17,18)16-10-9-13-11-14(15(3,4)5)8-7-12(13)2/h7-8,11,16H,6,9-10H2,1-5H3 |
| InChIKey | ZVNOHNGNALWRQV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |