C16H27NO4S — CID 110757792
5-tert-butyl-4-methoxy-N-(3-methoxypropyl)-2-methylbenzenesulfonamide (PubChem CID 110757792) has the molecular formula C16H27NO4S and a molecular weight of 329.46 g/mol. Its IUPAC name is 5-tert-butyl-4-methoxy-N-(3-methoxypropyl)-2-methylbenzenesulfonamide.
| Compound Name | 5-tert-butyl-4-methoxy-N-(3-methoxypropyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110757792 |
| Molecular Formula | C16H27NO4S |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 5-tert-butyl-4-methoxy-N-(3-methoxypropyl)-2-methylbenzenesulfonamide |
| SMILES | COCCCNS(=O)(=O)c1cc(C(C)(C)C)c(OC)cc1C |
| InChI | InChI=1S/C16H27NO4S/c1-12-10-14(21-6)13(16(2,3)4)11-15(12)22(18,19)17-8-7-9-20-5/h10-11,17H,7-9H2,1-6H3 |
| InChIKey | YYUYDMDACPHEPC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|